About CID 145408954
CID 145408954 (PubChem CID 145408954) has the molecular formula C17H27N2O3
and a molecular weight of 307.41 g/mol.
Molecular Properties
| Compound Name | CID 145408954 |
| PubChem CID | 145408954 |
| Molecular Formula | C17H27N2O3 |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C1=C[CH]1.CCOC(=O)CN(CCCC#N)C(C)=O |
| InChI | InChI=1S/C10H16N2O3.C7H11/c1-3-15-10(14)8-12(9(2)13)7-5-4-6-11;1-7(2,3)6-4-5-6/h3-5,7-8H2,1-2H3;4-5H,1-3H3 |
| InChIKey | AWDDRLYORNJKAU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 145408954 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145408954?
The IUPAC name of CID 145408954 (CID 145408954) is not available.
What is the SMILES notation for CID 145408954?
The canonical SMILES for CID 145408954 is CC(C)(C)C1=C[CH]1.CCOC(=O)CN(CCCC#N)C(C)=O.
What is the InChIKey of CID 145408954?
The InChIKey is AWDDRLYORNJKAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3.C7H11/c1-3-15-10(14)8-12(9(2)13)7-5-4-6-11;1-7(2,3)6-4-5-6/h3-5,7-8H2,1-2H3;4-5H,1-3H3.
What are the key properties of CID 145408954?
CID 145408954 has a molecular weight of 307.41 g/mol, XLogP of 2.88, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145408954 is sourced from PubChem (CID 145408954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).