C22H26BN3O2 — CID 145409251
(Z)-2-[2-ethenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(1-methylpyrazol-4-yl)but-2-enenitrile (PubChem CID 145409251) has the molecular formula C22H26BN3O2 and a molecular weight of 375.28 g/mol. Its IUPAC name is (Z)-2-[2-ethenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(1-methylpyrazol-4-yl)but-2-enenitrile.
| Compound Name | (Z)-2-[2-ethenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(1-methylpyrazol-4-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 145409251 |
| Molecular Formula | C22H26BN3O2 |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | (Z)-2-[2-ethenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-(1-methylpyrazol-4-yl)but-2-enenitrile |
| SMILES | C=Cc1c(B2OC(C)(C)C(C)(C)O2)cccc1/C(C#N)=C(\C)c1cnn(C)c1 |
| InChI | InChI=1S/C22H26BN3O2/c1-8-17-18(19(12-24)15(2)16-13-25-26(7)14-16)10-9-11-20(17)23-27-21(3,4)22(5,6)28-23/h8-11,13-14H,1H2,2-7H3/b19-15+ |
| InChIKey | XXZZOIGBPVQYLG-XDJHFCHBSA-N |
| XLogP | 3.82 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|