C20H23N3O — CID 145409289
ethane;3-methyl-N-(1-methyl-5-phenylimidazol-2-yl)benzamide (PubChem CID 145409289) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is ethane;3-methyl-N-(1-methyl-5-phenylimidazol-2-yl)benzamide.
| Compound Name | ethane;3-methyl-N-(1-methyl-5-phenylimidazol-2-yl)benzamide |
|---|---|
| PubChem CID | 145409289 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | ethane;3-methyl-N-(1-methyl-5-phenylimidazol-2-yl)benzamide |
| SMILES | CC.Cc1cccc(C(=O)Nc2ncc(-c3ccccc3)n2C)c1 |
| InChI | InChI=1S/C18H17N3O.C2H6/c1-13-7-6-10-15(11-13)17(22)20-18-19-12-16(21(18)2)14-8-4-3-5-9-14;1-2/h3-12H,1-2H3,(H,19,20,22);1-2H3 |
| InChIKey | ZNQAAFJYFFUVAN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |