About tetradeca-1,2-dienyl acetate
tetradeca-1,2-dienyl acetate (PubChem CID 145409573) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is tetradeca-1,2-dienyl acetate.
Molecular Properties
| Compound Name | tetradeca-1,2-dienyl acetate |
| PubChem CID | 145409573 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | tetradeca-1,2-dienyl acetate |
| SMILES | CCCCCCCCCCCC=C=COC(C)=O |
| InChI | InChI=1S/C16H28O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h13,15H,3-12H2,1-2H3 |
| InChIKey | SWQFTHCBOVOIMA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tetradeca-1,2-dienyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradeca-1,2-dienyl acetate?
The IUPAC name of tetradeca-1,2-dienyl acetate (CID 145409573) is tetradeca-1,2-dienyl acetate.
What is the SMILES notation for tetradeca-1,2-dienyl acetate?
The canonical SMILES for tetradeca-1,2-dienyl acetate is CCCCCCCCCCCC=C=COC(C)=O.
What is the InChIKey of tetradeca-1,2-dienyl acetate?
The InChIKey is SWQFTHCBOVOIMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h13,15H,3-12H2,1-2H3.
What are the key properties of tetradeca-1,2-dienyl acetate?
tetradeca-1,2-dienyl acetate has a molecular weight of 252.40 g/mol, XLogP of 5.14, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tetradeca-1,2-dienyl acetate is sourced from PubChem (CID 145409573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).