About 7-O-benzyl 8-O-ethyl (8S)-1,4-dithia-7-azaspiro[4.4]nonane-7,8-dicarboxylate
7-O-benzyl 8-O-ethyl (8S)-1,4-dithia-7-azaspiro[4.4]nonane-7,8-dicarboxylate (PubChem CID 14540988) has the molecular formula C17H21NO4S2
and a molecular weight of 367.49 g/mol. Its IUPAC name is 7-O-benzyl 8-O-ethyl (8S)-1,4-dithia-7-azaspiro[4.4]nonane-7,8-dicarboxylate.
Molecular Properties
| Compound Name | 7-O-benzyl 8-O-ethyl (8S)-1,4-dithia-7-azaspiro[4.4]nonane-7,8-dicarboxylate |
| PubChem CID | 14540988 |
| Molecular Formula | C17H21NO4S2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 7-O-benzyl 8-O-ethyl (8S)-1,4-dithia-7-azaspiro[4.4]nonane-7,8-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CC2(CN1C(=O)OCc1ccccc1)SCCS2 |
| InChI | InChI=1S/C17H21NO4S2/c1-2-21-15(19)14-10-17(23-8-9-24-17)12-18(14)16(20)22-11-13-6-4-3-5-7-13/h3-7,14H,2,8-12H2,1H3/t14-/m0/s1 |
| InChIKey | GSSGWFAVVMOIBA-AWEZNQCLSA-N |
| XLogP | 3.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-O-benzyl 8-O-ethyl (8S)-1,4-dithia-7-azaspiro[4.4]nonane-7,8-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-O-benzyl 8-O-ethyl (8S)-1,4-dithia-7-azaspiro[4.4]nonane-7,8-dicarboxylate?
The IUPAC name of 7-O-benzyl 8-O-ethyl (8S)-1,4-dithia-7-azaspiro[4.4]nonane-7,8-dicarboxylate (CID 14540988) is 7-O-benzyl 8-O-ethyl (8S)-1,4-dithia-7-azaspiro[4.4]nonane-7,8-dicarboxylate.
What is the SMILES notation for 7-O-benzyl 8-O-ethyl (8S)-1,4-dithia-7-azaspiro[4.4]nonane-7,8-dicarboxylate?
The canonical SMILES for 7-O-benzyl 8-O-ethyl (8S)-1,4-dithia-7-azaspiro[4.4]nonane-7,8-dicarboxylate is CCOC(=O)[C@@H]1CC2(CN1C(=O)OCc1ccccc1)SCCS2.
What is the InChIKey of 7-O-benzyl 8-O-ethyl (8S)-1,4-dithia-7-azaspiro[4.4]nonane-7,8-dicarboxylate?
The InChIKey is GSSGWFAVVMOIBA-AWEZNQCLSA-N. The full InChI is InChI=1S/C17H21NO4S2/c1-2-21-15(19)14-10-17(23-8-9-24-17)12-18(14)16(20)22-11-13-6-4-3-5-7-13/h3-7,14H,2,8-12H2,1H3/t14-/m0/s1.
What are the key properties of 7-O-benzyl 8-O-ethyl (8S)-1,4-dithia-7-azaspiro[4.4]nonane-7,8-dicarboxylate?
7-O-benzyl 8-O-ethyl (8S)-1,4-dithia-7-azaspiro[4.4]nonane-7,8-dicarboxylate has a molecular weight of 367.49 g/mol, XLogP of 3.14, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-O-benzyl 8-O-ethyl (8S)-1,4-dithia-7-azaspiro[4.4]nonane-7,8-dicarboxylate is sourced from PubChem (CID 14540988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).