About 1-methoxyborolan-3-amine
1-methoxyborolan-3-amine (PubChem CID 145409930) has the molecular formula C5H12BNO
and a molecular weight of 112.97 g/mol. Its IUPAC name is 1-methoxyborolan-3-amine.
Molecular Properties
| Compound Name | 1-methoxyborolan-3-amine |
| PubChem CID | 145409930 |
| Molecular Formula | C5H12BNO |
| Molecular Weight | 112.97 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | 1-methoxyborolan-3-amine |
| SMILES | COB1CCC(N)C1 |
| InChI | InChI=1S/C5H12BNO/c1-8-6-3-2-5(7)4-6/h5H,2-4,7H2,1H3 |
| InChIKey | PUGMUFOIJUZKEA-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.97 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxyborolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyborolan-3-amine?
The IUPAC name of 1-methoxyborolan-3-amine (CID 145409930) is 1-methoxyborolan-3-amine.
What is the SMILES notation for 1-methoxyborolan-3-amine?
The canonical SMILES for 1-methoxyborolan-3-amine is COB1CCC(N)C1.
What is the InChIKey of 1-methoxyborolan-3-amine?
The InChIKey is PUGMUFOIJUZKEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12BNO/c1-8-6-3-2-5(7)4-6/h5H,2-4,7H2,1H3.
What are the key properties of 1-methoxyborolan-3-amine?
1-methoxyborolan-3-amine has a molecular weight of 112.97 g/mol, XLogP of 0.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyborolan-3-amine is sourced from PubChem (CID 145409930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).