C8H12ClN3O3S — CID 145410023
2-[[4-chloro-6-(methylsulfonylmethyl)pyrimidin-2-yl]amino]ethanol (PubChem CID 145410023) has the molecular formula C8H12ClN3O3S and a molecular weight of 265.72 g/mol. Its IUPAC name is 2-[[4-chloro-6-(methylsulfonylmethyl)pyrimidin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-chloro-6-(methylsulfonylmethyl)pyrimidin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 145410023 |
| Molecular Formula | C8H12ClN3O3S |
| Molecular Weight | 265.72 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 2-[[4-chloro-6-(methylsulfonylmethyl)pyrimidin-2-yl]amino]ethanol |
| SMILES | CS(=O)(=O)Cc1cc(Cl)nc(NCCO)n1 |
| InChI | InChI=1S/C8H12ClN3O3S/c1-16(14,15)5-6-4-7(9)12-8(11-6)10-2-3-13/h4,13H,2-3,5H2,1H3,(H,10,11,12) |
| InChIKey | XTAJQOIMFNTXQD-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.72 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |