C33H43N9O3 — CID 145410093
N-[4-[[6-amino-5-[4-(2-piperidin-1-ylethoxy)benzenecarboximidoyl]pyrimidin-4-yl]amino]phenyl]formamide;5-tert-butyl-N-methyl-1,2-oxazol-3-amine (PubChem CID 145410093) has the molecular formula C33H43N9O3 and a molecular weight of 613.77 g/mol. Its IUPAC name is N-[4-[[6-amino-5-[4-(2-piperidin-1-ylethoxy)benzenecarboximidoyl]pyrimidin-4-yl]amino]phenyl]formamide;5-tert-butyl-N-methyl-1,2-oxazol-3-amine.
| Compound Name | N-[4-[[6-amino-5-[4-(2-piperidin-1-ylethoxy)benzenecarboximidoyl]pyrimidin-4-yl]amino]phenyl]formamide;5-tert-butyl-N-methyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 145410093 |
| Molecular Formula | C33H43N9O3 |
| Molecular Weight | 613.77 g/mol |
| Exact Mass | 613.35 |
| IUPAC Name | N-[4-[[6-amino-5-[4-(2-piperidin-1-ylethoxy)benzenecarboximidoyl]pyrimidin-4-yl]amino]phenyl]formamide;5-tert-butyl-N-methyl-1,2-oxazol-3-amine |
| SMILES | CNc1cc(C(C)(C)C)on1.[H]/N=C(\c1ccc(OCCN2CCCCC2)cc1)c1c(N)ncnc1Nc1ccc(NC=O)cc1 |
| InChI | InChI=1S/C25H29N7O2.C8H14N2O/c26-23(18-4-10-21(11-5-18)34-15-14-32-12-2-1-3-13-32)22-24(27)28-16-29-25(22)31-20-8-6-19(7-9-20)30-17-33;1-8(2,3)6-5-7(9-4)10-11-6/h4-11,16-17,26H,1-3,12-15H2,(H,30,33)(H3,27,28,29,31);5H,1-4H3,(H,9,10)/b26-23+; |
| InChIKey | JYDWFFXGHOEUSL-VQSOISJUSA-N |
| XLogP | 5.67 |
| TPSA | 167.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.77 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|