About 4,5-dihydroxy-5-(hydroxymethyl)-2-oxo-1,3-dioxolane-4-carboxylic acid
4,5-dihydroxy-5-(hydroxymethyl)-2-oxo-1,3-dioxolane-4-carboxylic acid (PubChem CID 145410346) has the molecular formula C5H6O8
and a molecular weight of 194.09 g/mol. Its IUPAC name is 4,5-dihydroxy-5-(hydroxymethyl)-2-oxo-1,3-dioxolane-4-carboxylic acid.
Molecular Properties
| Compound Name | 4,5-dihydroxy-5-(hydroxymethyl)-2-oxo-1,3-dioxolane-4-carboxylic acid |
| PubChem CID | 145410346 |
| Molecular Formula | C5H6O8 |
| Molecular Weight | 194.09 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 4,5-dihydroxy-5-(hydroxymethyl)-2-oxo-1,3-dioxolane-4-carboxylic acid |
| SMILES | O=C1OC(O)(CO)C(O)(C(=O)O)O1 |
| InChI | InChI=1S/C5H6O8/c6-1-4(10)5(11,2(7)8)13-3(9)12-4/h6,10-11H,1H2,(H,7,8) |
| InChIKey | QJLVNJQTPVLGIK-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.09 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4,5-dihydroxy-5-(hydroxymethyl)-2-oxo-1,3-dioxolane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydroxy-5-(hydroxymethyl)-2-oxo-1,3-dioxolane-4-carboxylic acid?
The IUPAC name of 4,5-dihydroxy-5-(hydroxymethyl)-2-oxo-1,3-dioxolane-4-carboxylic acid (CID 145410346) is 4,5-dihydroxy-5-(hydroxymethyl)-2-oxo-1,3-dioxolane-4-carboxylic acid.
What is the SMILES notation for 4,5-dihydroxy-5-(hydroxymethyl)-2-oxo-1,3-dioxolane-4-carboxylic acid?
The canonical SMILES for 4,5-dihydroxy-5-(hydroxymethyl)-2-oxo-1,3-dioxolane-4-carboxylic acid is O=C1OC(O)(CO)C(O)(C(=O)O)O1.
What is the InChIKey of 4,5-dihydroxy-5-(hydroxymethyl)-2-oxo-1,3-dioxolane-4-carboxylic acid?
The InChIKey is QJLVNJQTPVLGIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O8/c6-1-4(10)5(11,2(7)8)13-3(9)12-4/h6,10-11H,1H2,(H,7,8).
What are the key properties of 4,5-dihydroxy-5-(hydroxymethyl)-2-oxo-1,3-dioxolane-4-carboxylic acid?
4,5-dihydroxy-5-(hydroxymethyl)-2-oxo-1,3-dioxolane-4-carboxylic acid has a molecular weight of 194.09 g/mol, XLogP of -2.39, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydroxy-5-(hydroxymethyl)-2-oxo-1,3-dioxolane-4-carboxylic acid is sourced from PubChem (CID 145410346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).