C26H42OSi — CID 14541046
(8S,9S,13R,14S,17R)-13-methyl-17-(2-triethylsilylethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 14541046) has the molecular formula C26H42OSi and a molecular weight of 398.71 g/mol. Its IUPAC name is (8S,9S,13R,14S,17R)-13-methyl-17-(2-triethylsilylethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (8S,9S,13R,14S,17R)-13-methyl-17-(2-triethylsilylethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 14541046 |
| Molecular Formula | C26H42OSi |
| Molecular Weight | 398.71 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | (8S,9S,13R,14S,17R)-13-methyl-17-(2-triethylsilylethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC[Si](CC)(CC)CC[C@H]1CC[C@H]2[C@@H]3CCc4cc(O)ccc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H42OSi/c1-5-28(6-2,7-3)17-15-20-9-13-25-24-11-8-19-18-21(27)10-12-22(19)23(24)14-16-26(20,25)4/h10,12,18,20,23-25,27H,5-9,11,13-17H2,1-4H3/t20-,23-,24-,25+,26-/m1/s1 |
| InChIKey | JULBEXDPARGASB-QAICKBLRSA-N |
| XLogP | 7.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.71 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|