C19H35NO — CID 145410814
(11Z)-13-methoxy-5,6,9-trimethyl-10-methylidenetetradeca-11,13-dien-2-amine (PubChem CID 145410814) has the molecular formula C19H35NO and a molecular weight of 293.50 g/mol. Its IUPAC name is (11Z)-13-methoxy-5,6,9-trimethyl-10-methylidenetetradeca-11,13-dien-2-amine.
| Compound Name | (11Z)-13-methoxy-5,6,9-trimethyl-10-methylidenetetradeca-11,13-dien-2-amine |
|---|---|
| PubChem CID | 145410814 |
| Molecular Formula | C19H35NO |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | (11Z)-13-methoxy-5,6,9-trimethyl-10-methylidenetetradeca-11,13-dien-2-amine |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)C(C)CCC(C)N)OC |
| InChI | InChI=1S/C19H35NO/c1-14(16(3)10-12-18(5)20)8-9-15(2)17(4)11-13-19(6)21-7/h11,13-16,18H,4,6,8-10,12,20H2,1-3,5,7H3/b13-11- |
| InChIKey | BJJRZNRKOIVDIK-QBFSEMIESA-N |
| XLogP | 5.07 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|