C26H20N2O7 — CID 145412178
1-[5-[3-(2,5-dioxopyrrol-1-yl)-4-prop-2-enoxyphenoxy]-2-prop-2-enoxyphenyl]pyrrole-2,5-dione (PubChem CID 145412178) has the molecular formula C26H20N2O7 and a molecular weight of 472.45 g/mol. Its IUPAC name is 1-[5-[3-(2,5-dioxopyrrol-1-yl)-4-prop-2-enoxyphenoxy]-2-prop-2-enoxyphenyl]pyrrole-2,5-dione.
| Compound Name | 1-[5-[3-(2,5-dioxopyrrol-1-yl)-4-prop-2-enoxyphenoxy]-2-prop-2-enoxyphenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 145412178 |
| Molecular Formula | C26H20N2O7 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 1-[5-[3-(2,5-dioxopyrrol-1-yl)-4-prop-2-enoxyphenoxy]-2-prop-2-enoxyphenyl]pyrrole-2,5-dione |
| SMILES | C=CCOc1ccc(Oc2ccc(OCC=C)c(N3C(=O)C=CC3=O)c2)cc1N1C(=O)C=CC1=O |
| InChI | InChI=1S/C26H20N2O7/c1-3-13-33-21-7-5-17(15-19(21)27-23(29)9-10-24(27)30)35-18-6-8-22(34-14-4-2)20(16-18)28-25(31)11-12-26(28)32/h3-12,15-16H,1-2,13-14H2 |
| InChIKey | XPFSXHRSVASVPN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|