C21H20F3N5O — CID 145412201
1-[5-(hydroxymethyl)-2-methylphenyl]-3-[1-(1H-imidazol-5-yl)ethenyl]-2-[(3,4,5-trifluorophenyl)methyl]guanidine (PubChem CID 145412201) has the molecular formula C21H20F3N5O and a molecular weight of 415.42 g/mol. Its IUPAC name is 1-[5-(hydroxymethyl)-2-methylphenyl]-3-[1-(1H-imidazol-5-yl)ethenyl]-2-[(3,4,5-trifluorophenyl)methyl]guanidine.
| Compound Name | 1-[5-(hydroxymethyl)-2-methylphenyl]-3-[1-(1H-imidazol-5-yl)ethenyl]-2-[(3,4,5-trifluorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 145412201 |
| Molecular Formula | C21H20F3N5O |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1-[5-(hydroxymethyl)-2-methylphenyl]-3-[1-(1H-imidazol-5-yl)ethenyl]-2-[(3,4,5-trifluorophenyl)methyl]guanidine |
| SMILES | C=C(N/C(=N\Cc1cc(F)c(F)c(F)c1)Nc1cc(CO)ccc1C)c1cnc[nH]1 |
| InChI | InChI=1S/C21H20F3N5O/c1-12-3-4-14(10-30)7-18(12)29-21(28-13(2)19-9-25-11-27-19)26-8-15-5-16(22)20(24)17(23)6-15/h3-7,9,11,30H,2,8,10H2,1H3,(H,25,27)(H2,26,28,29) |
| InChIKey | VCTYUNQJDROKOG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|