About 3-benzyl-2-(4-chloro-2,5-dimethylanilino)-7H-purin-6-one
3-benzyl-2-(4-chloro-2,5-dimethylanilino)-7H-purin-6-one (PubChem CID 145412382) has the molecular formula C20H18ClN5O
and a molecular weight of 379.85 g/mol. Its IUPAC name is 3-benzyl-2-(4-chloro-2,5-dimethylanilino)-7H-purin-6-one.
Molecular Properties
| Compound Name | 3-benzyl-2-(4-chloro-2,5-dimethylanilino)-7H-purin-6-one |
| PubChem CID | 145412382 |
| Molecular Formula | C20H18ClN5O |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 3-benzyl-2-(4-chloro-2,5-dimethylanilino)-7H-purin-6-one |
| SMILES | Cc1cc(Nc2nc(=O)c3[nH]cnc3n2Cc2ccccc2)c(C)cc1Cl |
| InChI | InChI=1S/C20H18ClN5O/c1-12-9-16(13(2)8-15(12)21)24-20-25-19(27)17-18(23-11-22-17)26(20)10-14-6-4-3-5-7-14/h3-9,11H,10H2,1-2H3,(H,22,23)(H,24,25,27) |
| InChIKey | VPASUJJILFPCRL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-benzyl-2-(4-chloro-2,5-dimethylanilino)-7H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-2-(4-chloro-2,5-dimethylanilino)-7H-purin-6-one?
The IUPAC name of 3-benzyl-2-(4-chloro-2,5-dimethylanilino)-7H-purin-6-one (CID 145412382) is 3-benzyl-2-(4-chloro-2,5-dimethylanilino)-7H-purin-6-one.
What is the SMILES notation for 3-benzyl-2-(4-chloro-2,5-dimethylanilino)-7H-purin-6-one?
The canonical SMILES for 3-benzyl-2-(4-chloro-2,5-dimethylanilino)-7H-purin-6-one is Cc1cc(Nc2nc(=O)c3[nH]cnc3n2Cc2ccccc2)c(C)cc1Cl.
What is the InChIKey of 3-benzyl-2-(4-chloro-2,5-dimethylanilino)-7H-purin-6-one?
The InChIKey is VPASUJJILFPCRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18ClN5O/c1-12-9-16(13(2)8-15(12)21)24-20-25-19(27)17-18(23-11-22-17)26(20)10-14-6-4-3-5-7-14/h3-9,11H,10H2,1-2H3,(H,22,23)(H,24,25,27).
What are the key properties of 3-benzyl-2-(4-chloro-2,5-dimethylanilino)-7H-purin-6-one?
3-benzyl-2-(4-chloro-2,5-dimethylanilino)-7H-purin-6-one has a molecular weight of 379.85 g/mol, XLogP of 4.18, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-2-(4-chloro-2,5-dimethylanilino)-7H-purin-6-one is sourced from PubChem (CID 145412382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).