About 2-chloro-1,4-bis(4-methylsulfanylphenyl)benzene;ethane
2-chloro-1,4-bis(4-methylsulfanylphenyl)benzene;ethane (PubChem CID 145412484) has the molecular formula C22H23ClS2
and a molecular weight of 387.01 g/mol. Its IUPAC name is 2-chloro-1,4-bis(4-methylsulfanylphenyl)benzene;ethane.
Molecular Properties
| Compound Name | 2-chloro-1,4-bis(4-methylsulfanylphenyl)benzene;ethane |
| PubChem CID | 145412484 |
| Molecular Formula | C22H23ClS2 |
| Molecular Weight | 387.01 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 2-chloro-1,4-bis(4-methylsulfanylphenyl)benzene;ethane |
| SMILES | CC.CSc1ccc(-c2ccc(-c3ccc(SC)cc3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H17ClS2.C2H6/c1-22-17-8-3-14(4-9-17)16-7-12-19(20(21)13-16)15-5-10-18(23-2)11-6-15;1-2/h3-13H,1-2H3;1-2H3 |
| InChIKey | JOWLFJKJPWEGBK-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.01 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-1,4-bis(4-methylsulfanylphenyl)benzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,4-bis(4-methylsulfanylphenyl)benzene;ethane?
The IUPAC name of 2-chloro-1,4-bis(4-methylsulfanylphenyl)benzene;ethane (CID 145412484) is 2-chloro-1,4-bis(4-methylsulfanylphenyl)benzene;ethane.
What is the SMILES notation for 2-chloro-1,4-bis(4-methylsulfanylphenyl)benzene;ethane?
The canonical SMILES for 2-chloro-1,4-bis(4-methylsulfanylphenyl)benzene;ethane is CC.CSc1ccc(-c2ccc(-c3ccc(SC)cc3)c(Cl)c2)cc1.
What is the InChIKey of 2-chloro-1,4-bis(4-methylsulfanylphenyl)benzene;ethane?
The InChIKey is JOWLFJKJPWEGBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClS2.C2H6/c1-22-17-8-3-14(4-9-17)16-7-12-19(20(21)13-16)15-5-10-18(23-2)11-6-15;1-2/h3-13H,1-2H3;1-2H3.
What are the key properties of 2-chloro-1,4-bis(4-methylsulfanylphenyl)benzene;ethane?
2-chloro-1,4-bis(4-methylsulfanylphenyl)benzene;ethane has a molecular weight of 387.01 g/mol, XLogP of 8.14, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,4-bis(4-methylsulfanylphenyl)benzene;ethane is sourced from PubChem (CID 145412484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).