C40H20N6S4 — CID 145413503
[3,4-di(phenothiazin-10-yl)-13-thiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-12-yl] thiocyanate (PubChem CID 145413503) has the molecular formula C40H20N6S4 and a molecular weight of 712.91 g/mol. Its IUPAC name is [3,4-di(phenothiazin-10-yl)-13-thiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-12-yl] thiocyanate.
| Compound Name | [3,4-di(phenothiazin-10-yl)-13-thiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-12-yl] thiocyanate |
|---|---|
| PubChem CID | 145413503 |
| Molecular Formula | C40H20N6S4 |
| Molecular Weight | 712.91 g/mol |
| Exact Mass | 712.06 |
| IUPAC Name | [3,4-di(phenothiazin-10-yl)-13-thiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-12-yl] thiocyanate |
| SMILES | N#CSc1nc2c(nc1SC#N)-c1cc(N3c4ccccc4Sc4ccccc43)c(N3c4ccccc4Sc4ccccc43)c3cccc-2c13 |
| InChI | InChI=1S/C40H20N6S4/c41-21-47-39-40(48-22-42)44-37-25-20-30(45-26-12-1-5-16-31(26)49-32-17-6-2-13-27(32)45)38(24-11-9-10-23(35(24)25)36(37)43-39)46-28-14-3-7-18-33(28)50-34-19-8-4-15-29(34)46/h1-20H |
| InChIKey | PFOIRNBJNHGJIG-UHFFFAOYSA-N |
| XLogP | 12.29 |
| TPSA | 79.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.91 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|