C28H12FN5OS2 — CID 145413557
(3-fluoro-6-phenoxazin-10-yl-13-thiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10(15),11,13-octaen-12-yl) thiocyanate (PubChem CID 145413557) has the molecular formula C28H12FN5OS2 and a molecular weight of 517.57 g/mol. Its IUPAC name is (3-fluoro-6-phenoxazin-10-yl-13-thiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10(15),11,13-octaen-12-yl) thiocyanate.
| Compound Name | (3-fluoro-6-phenoxazin-10-yl-13-thiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10(15),11,13-octaen-12-yl) thiocyanate |
|---|---|
| PubChem CID | 145413557 |
| Molecular Formula | C28H12FN5OS2 |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | (3-fluoro-6-phenoxazin-10-yl-13-thiocyanato-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10(15),11,13-octaen-12-yl) thiocyanate |
| SMILES | N#CSc1nc2c(nc1SC#N)-c1cc(F)cc3c(N4c5ccccc5Oc5ccccc54)ccc-2c13 |
| InChI | InChI=1S/C28H12FN5OS2/c29-15-11-17-19(34-20-5-1-3-7-22(20)35-23-8-4-2-6-21(23)34)10-9-16-24(17)18(12-15)26-25(16)32-27(36-13-30)28(33-26)37-14-31/h1-12H |
| InChIKey | RJLJCCXNUNNHDP-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 85.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|