C19H17NO — CID 145413862
10-(3-methylphenyl)-3,4-dihydrophenoxazine (PubChem CID 145413862) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is 10-(3-methylphenyl)-3,4-dihydrophenoxazine.
| Compound Name | 10-(3-methylphenyl)-3,4-dihydrophenoxazine |
|---|---|
| PubChem CID | 145413862 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 10-(3-methylphenyl)-3,4-dihydrophenoxazine |
| SMILES | Cc1cccc(N2C3=C(CCC=C3)Oc3ccccc32)c1 |
| InChI | InChI=1S/C19H17NO/c1-14-7-6-8-15(13-14)20-16-9-2-4-11-18(16)21-19-12-5-3-10-17(19)20/h2-4,6-11,13H,5,12H2,1H3 |
| InChIKey | ZICGAGFSSPKZKP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |