C34H16FN5O — CID 145413865
3-fluoro-6-(4-phenoxazin-10-ylphenyl)-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene-12,13-dicarbonitrile (PubChem CID 145413865) has the molecular formula C34H16FN5O and a molecular weight of 529.53 g/mol. Its IUPAC name is 3-fluoro-6-(4-phenoxazin-10-ylphenyl)-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene-12,13-dicarbonitrile.
| Compound Name | 3-fluoro-6-(4-phenoxazin-10-ylphenyl)-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene-12,13-dicarbonitrile |
|---|---|
| PubChem CID | 145413865 |
| Molecular Formula | C34H16FN5O |
| Molecular Weight | 529.53 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | 3-fluoro-6-(4-phenoxazin-10-ylphenyl)-11,14-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene-12,13-dicarbonitrile |
| SMILES | N#Cc1nc2c(nc1C#N)-c1cc(F)cc3c(-c4ccc(N5c6ccccc6Oc6ccccc65)cc4)ccc-2c13 |
| InChI | InChI=1S/C34H16FN5O/c35-20-15-24-22(13-14-23-32(24)25(16-20)34-33(23)38-26(17-36)27(18-37)39-34)19-9-11-21(12-10-19)40-28-5-1-3-7-30(28)41-31-8-4-2-6-29(31)40/h1-16H |
| InChIKey | DAWLANBOEZMNIC-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 85.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.53 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |