About ethane;5-ethenyl-3,3-difluoro-4-prop-1-en-2-yl-1H-pyrrol-2-one
ethane;5-ethenyl-3,3-difluoro-4-prop-1-en-2-yl-1H-pyrrol-2-one (PubChem CID 145414211) has the molecular formula C11H15F2NO
and a molecular weight of 215.24 g/mol. Its IUPAC name is ethane;5-ethenyl-3,3-difluoro-4-prop-1-en-2-yl-1H-pyrrol-2-one.
Molecular Properties
| Compound Name | ethane;5-ethenyl-3,3-difluoro-4-prop-1-en-2-yl-1H-pyrrol-2-one |
| PubChem CID | 145414211 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | ethane;5-ethenyl-3,3-difluoro-4-prop-1-en-2-yl-1H-pyrrol-2-one |
| SMILES | C=CC1=C(C(=C)C)C(F)(F)C(=O)N1.CC |
| InChI | InChI=1S/C9H9F2NO.C2H6/c1-4-6-7(5(2)3)9(10,11)8(13)12-6;1-2/h4H,1-2H2,3H3,(H,12,13);1-2H3 |
| InChIKey | DQEKFWVGFVIXHR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;5-ethenyl-3,3-difluoro-4-prop-1-en-2-yl-1H-pyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethenyl-3,3-difluoro-4-prop-1-en-2-yl-1H-pyrrol-2-one?
The IUPAC name of ethane;5-ethenyl-3,3-difluoro-4-prop-1-en-2-yl-1H-pyrrol-2-one (CID 145414211) is ethane;5-ethenyl-3,3-difluoro-4-prop-1-en-2-yl-1H-pyrrol-2-one.
What is the SMILES notation for ethane;5-ethenyl-3,3-difluoro-4-prop-1-en-2-yl-1H-pyrrol-2-one?
The canonical SMILES for ethane;5-ethenyl-3,3-difluoro-4-prop-1-en-2-yl-1H-pyrrol-2-one is C=CC1=C(C(=C)C)C(F)(F)C(=O)N1.CC.
What is the InChIKey of ethane;5-ethenyl-3,3-difluoro-4-prop-1-en-2-yl-1H-pyrrol-2-one?
The InChIKey is DQEKFWVGFVIXHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO.C2H6/c1-4-6-7(5(2)3)9(10,11)8(13)12-6;1-2/h4H,1-2H2,3H3,(H,12,13);1-2H3.
What are the key properties of ethane;5-ethenyl-3,3-difluoro-4-prop-1-en-2-yl-1H-pyrrol-2-one?
ethane;5-ethenyl-3,3-difluoro-4-prop-1-en-2-yl-1H-pyrrol-2-one has a molecular weight of 215.24 g/mol, XLogP of 2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethenyl-3,3-difluoro-4-prop-1-en-2-yl-1H-pyrrol-2-one is sourced from PubChem (CID 145414211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).