About ethane;(2E)-2-hydroxyimino-N-(5-methylcyclohexa-1,5-dien-1-yl)acetamide
ethane;(2E)-2-hydroxyimino-N-(5-methylcyclohexa-1,5-dien-1-yl)acetamide (PubChem CID 145414229) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is ethane;(2E)-2-hydroxyimino-N-(5-methylcyclohexa-1,5-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | ethane;(2E)-2-hydroxyimino-N-(5-methylcyclohexa-1,5-dien-1-yl)acetamide |
| PubChem CID | 145414229 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | ethane;(2E)-2-hydroxyimino-N-(5-methylcyclohexa-1,5-dien-1-yl)acetamide |
| SMILES | CC.CC1=CC(NC(=O)/C=N/O)=CCC1 |
| InChI | InChI=1S/C9H12N2O2.C2H6/c1-7-3-2-4-8(5-7)11-9(12)6-10-13;1-2/h4-6,13H,2-3H2,1H3,(H,11,12);1-2H3/b10-6+; |
| InChIKey | ZQZROMBNCDNJRF-AAGWESIMSA-N |
| XLogP | 2.21 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2E)-2-hydroxyimino-N-(5-methylcyclohexa-1,5-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2E)-2-hydroxyimino-N-(5-methylcyclohexa-1,5-dien-1-yl)acetamide?
The IUPAC name of ethane;(2E)-2-hydroxyimino-N-(5-methylcyclohexa-1,5-dien-1-yl)acetamide (CID 145414229) is ethane;(2E)-2-hydroxyimino-N-(5-methylcyclohexa-1,5-dien-1-yl)acetamide.
What is the SMILES notation for ethane;(2E)-2-hydroxyimino-N-(5-methylcyclohexa-1,5-dien-1-yl)acetamide?
The canonical SMILES for ethane;(2E)-2-hydroxyimino-N-(5-methylcyclohexa-1,5-dien-1-yl)acetamide is CC.CC1=CC(NC(=O)/C=N/O)=CCC1.
What is the InChIKey of ethane;(2E)-2-hydroxyimino-N-(5-methylcyclohexa-1,5-dien-1-yl)acetamide?
The InChIKey is ZQZROMBNCDNJRF-AAGWESIMSA-N. The full InChI is InChI=1S/C9H12N2O2.C2H6/c1-7-3-2-4-8(5-7)11-9(12)6-10-13;1-2/h4-6,13H,2-3H2,1H3,(H,11,12);1-2H3/b10-6+;.
What are the key properties of ethane;(2E)-2-hydroxyimino-N-(5-methylcyclohexa-1,5-dien-1-yl)acetamide?
ethane;(2E)-2-hydroxyimino-N-(5-methylcyclohexa-1,5-dien-1-yl)acetamide has a molecular weight of 210.28 g/mol, XLogP of 2.21, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2E)-2-hydroxyimino-N-(5-methylcyclohexa-1,5-dien-1-yl)acetamide is sourced from PubChem (CID 145414229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).