C13H20O — CID 145414538
(1R)-2,8a-dimethyl-6-methylidene-1,2,3,4,7,8-hexahydronaphthalen-1-ol (PubChem CID 145414538) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (1R)-2,8a-dimethyl-6-methylidene-1,2,3,4,7,8-hexahydronaphthalen-1-ol.
| Compound Name | (1R)-2,8a-dimethyl-6-methylidene-1,2,3,4,7,8-hexahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 145414538 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (1R)-2,8a-dimethyl-6-methylidene-1,2,3,4,7,8-hexahydronaphthalen-1-ol |
| SMILES | C=C1C=C2CCC(C)[C@@H](O)C2(C)CC1 |
| InChI | InChI=1S/C13H20O/c1-9-6-7-13(3)11(8-9)5-4-10(2)12(13)14/h8,10,12,14H,1,4-7H2,2-3H3/t10?,12-,13?/m1/s1 |
| InChIKey | WQGNCUHWNLPWOT-YXMLORGKSA-N |
| XLogP | 3.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |