C25H31ClN2O5 — CID 145414785
methyl 1-[3-(4-chlorophenoxy)propyl]-4-[[2-(4-methylphenoxy)acetyl]amino]piperidine-2-carboxylate (PubChem CID 145414785) has the molecular formula C25H31ClN2O5 and a molecular weight of 474.99 g/mol. Its IUPAC name is methyl 1-[3-(4-chlorophenoxy)propyl]-4-[[2-(4-methylphenoxy)acetyl]amino]piperidine-2-carboxylate.
| Compound Name | methyl 1-[3-(4-chlorophenoxy)propyl]-4-[[2-(4-methylphenoxy)acetyl]amino]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 145414785 |
| Molecular Formula | C25H31ClN2O5 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | methyl 1-[3-(4-chlorophenoxy)propyl]-4-[[2-(4-methylphenoxy)acetyl]amino]piperidine-2-carboxylate |
| SMILES | COC(=O)C1CC(NC(=O)COc2ccc(C)cc2)CCN1CCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H31ClN2O5/c1-18-4-8-22(9-5-18)33-17-24(29)27-20-12-14-28(23(16-20)25(30)31-2)13-3-15-32-21-10-6-19(26)7-11-21/h4-11,20,23H,3,12-17H2,1-2H3,(H,27,29) |
| InChIKey | UEPCGZBBZJVPBK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|