About 2-(difluoromethyl)phenol;[4-(2-pyrrolidin-1-ylethoxy)phenyl]methanol
2-(difluoromethyl)phenol;[4-(2-pyrrolidin-1-ylethoxy)phenyl]methanol (PubChem CID 145415542) has the molecular formula C20H25F2NO3
and a molecular weight of 365.42 g/mol. Its IUPAC name is 2-(difluoromethyl)phenol;[4-(2-pyrrolidin-1-ylethoxy)phenyl]methanol.
Molecular Properties
| Compound Name | 2-(difluoromethyl)phenol;[4-(2-pyrrolidin-1-ylethoxy)phenyl]methanol |
| PubChem CID | 145415542 |
| Molecular Formula | C20H25F2NO3 |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 2-(difluoromethyl)phenol;[4-(2-pyrrolidin-1-ylethoxy)phenyl]methanol |
| SMILES | OCc1ccc(OCCN2CCCC2)cc1.Oc1ccccc1C(F)F |
| InChI | InChI=1S/C13H19NO2.C7H6F2O/c15-11-12-3-5-13(6-4-12)16-10-9-14-7-1-2-8-14;8-7(9)5-3-1-2-4-6(5)10/h3-6,15H,1-2,7-11H2;1-4,7,10H |
| InChIKey | RUBQXFOJAXPSBB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(difluoromethyl)phenol;[4-(2-pyrrolidin-1-ylethoxy)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)phenol;[4-(2-pyrrolidin-1-ylethoxy)phenyl]methanol?
The IUPAC name of 2-(difluoromethyl)phenol;[4-(2-pyrrolidin-1-ylethoxy)phenyl]methanol (CID 145415542) is 2-(difluoromethyl)phenol;[4-(2-pyrrolidin-1-ylethoxy)phenyl]methanol.
What is the SMILES notation for 2-(difluoromethyl)phenol;[4-(2-pyrrolidin-1-ylethoxy)phenyl]methanol?
The canonical SMILES for 2-(difluoromethyl)phenol;[4-(2-pyrrolidin-1-ylethoxy)phenyl]methanol is OCc1ccc(OCCN2CCCC2)cc1.Oc1ccccc1C(F)F.
What is the InChIKey of 2-(difluoromethyl)phenol;[4-(2-pyrrolidin-1-ylethoxy)phenyl]methanol?
The InChIKey is RUBQXFOJAXPSBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2.C7H6F2O/c15-11-12-3-5-13(6-4-12)16-10-9-14-7-1-2-8-14;8-7(9)5-3-1-2-4-6(5)10/h3-6,15H,1-2,7-11H2;1-4,7,10H.
What are the key properties of 2-(difluoromethyl)phenol;[4-(2-pyrrolidin-1-ylethoxy)phenyl]methanol?
2-(difluoromethyl)phenol;[4-(2-pyrrolidin-1-ylethoxy)phenyl]methanol has a molecular weight of 365.42 g/mol, XLogP of 3.98, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)phenol;[4-(2-pyrrolidin-1-ylethoxy)phenyl]methanol is sourced from PubChem (CID 145415542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).