C18H28N2 — CID 145415743
3,5-dimethyl-2-propan-2-ylquinoxaline;ethane;prop-1-ene (PubChem CID 145415743) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 3,5-dimethyl-2-propan-2-ylquinoxaline;ethane;prop-1-ene.
| Compound Name | 3,5-dimethyl-2-propan-2-ylquinoxaline;ethane;prop-1-ene |
|---|---|
| PubChem CID | 145415743 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 3,5-dimethyl-2-propan-2-ylquinoxaline;ethane;prop-1-ene |
| SMILES | C=CC.CC.Cc1nc2c(C)cccc2nc1C(C)C |
| InChI | InChI=1S/C13H16N2.C3H6.C2H6/c1-8(2)12-10(4)14-13-9(3)6-5-7-11(13)15-12;1-3-2;1-2/h5-8H,1-4H3;3H,1H2,2H3;1-2H3 |
| InChIKey | VWXHAYIXEARUIJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|