About 3-(1,3-dihydroxypropan-2-ylamino)-N-propylpropane-1-sulfonamide;ethane
3-(1,3-dihydroxypropan-2-ylamino)-N-propylpropane-1-sulfonamide;ethane (PubChem CID 145415812) has the molecular formula C11H28N2O4S
and a molecular weight of 284.42 g/mol. Its IUPAC name is 3-(1,3-dihydroxypropan-2-ylamino)-N-propylpropane-1-sulfonamide;ethane.
Molecular Properties
| Compound Name | 3-(1,3-dihydroxypropan-2-ylamino)-N-propylpropane-1-sulfonamide;ethane |
| PubChem CID | 145415812 |
| Molecular Formula | C11H28N2O4S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 3-(1,3-dihydroxypropan-2-ylamino)-N-propylpropane-1-sulfonamide;ethane |
| SMILES | CC.CCCNS(=O)(=O)CCCNC(CO)CO |
| InChI | InChI=1S/C9H22N2O4S.C2H6/c1-2-4-11-16(14,15)6-3-5-10-9(7-12)8-13;1-2/h9-13H,2-8H2,1H3;1-2H3 |
| InChIKey | SNQCAUUTCBRSIY-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-dihydroxypropan-2-ylamino)-N-propylpropane-1-sulfonamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-dihydroxypropan-2-ylamino)-N-propylpropane-1-sulfonamide;ethane?
The IUPAC name of 3-(1,3-dihydroxypropan-2-ylamino)-N-propylpropane-1-sulfonamide;ethane (CID 145415812) is 3-(1,3-dihydroxypropan-2-ylamino)-N-propylpropane-1-sulfonamide;ethane.
What is the SMILES notation for 3-(1,3-dihydroxypropan-2-ylamino)-N-propylpropane-1-sulfonamide;ethane?
The canonical SMILES for 3-(1,3-dihydroxypropan-2-ylamino)-N-propylpropane-1-sulfonamide;ethane is CC.CCCNS(=O)(=O)CCCNC(CO)CO.
What is the InChIKey of 3-(1,3-dihydroxypropan-2-ylamino)-N-propylpropane-1-sulfonamide;ethane?
The InChIKey is SNQCAUUTCBRSIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2O4S.C2H6/c1-2-4-11-16(14,15)6-3-5-10-9(7-12)8-13;1-2/h9-13H,2-8H2,1H3;1-2H3.
What are the key properties of 3-(1,3-dihydroxypropan-2-ylamino)-N-propylpropane-1-sulfonamide;ethane?
3-(1,3-dihydroxypropan-2-ylamino)-N-propylpropane-1-sulfonamide;ethane has a molecular weight of 284.42 g/mol, XLogP of -0.33, 10 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dihydroxypropan-2-ylamino)-N-propylpropane-1-sulfonamide;ethane is sourced from PubChem (CID 145415812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).