C13H19NO4 — CID 145416144
ethane;[(2E,3E)-3-nitro-2-prop-2-enylidenehexa-3,5-dienyl] acetate (PubChem CID 145416144) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is ethane;[(2E,3E)-3-nitro-2-prop-2-enylidenehexa-3,5-dienyl] acetate.
| Compound Name | ethane;[(2E,3E)-3-nitro-2-prop-2-enylidenehexa-3,5-dienyl] acetate |
|---|---|
| PubChem CID | 145416144 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | ethane;[(2E,3E)-3-nitro-2-prop-2-enylidenehexa-3,5-dienyl] acetate |
| SMILES | C=C/C=C(COC(C)=O)\C(=C/C=C)[N+](=O)[O-].CC |
| InChI | InChI=1S/C11H13NO4.C2H6/c1-4-6-10(8-16-9(3)13)11(7-5-2)12(14)15;1-2/h4-7H,1-2,8H2,3H3;1-2H3/b10-6-,11-7+; |
| InChIKey | GVRKXCHZXPRFLG-MGEBMGQVSA-N |
| XLogP | 3.03 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|