C10H20N2O2 — CID 145416397
ethane;2-methyl-1,3,4,8,9,9a-hexahydropyrazino[1,2-c][1,3]oxazin-6-one (PubChem CID 145416397) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is ethane;2-methyl-1,3,4,8,9,9a-hexahydropyrazino[1,2-c][1,3]oxazin-6-one.
| Compound Name | ethane;2-methyl-1,3,4,8,9,9a-hexahydropyrazino[1,2-c][1,3]oxazin-6-one |
|---|---|
| PubChem CID | 145416397 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | ethane;2-methyl-1,3,4,8,9,9a-hexahydropyrazino[1,2-c][1,3]oxazin-6-one |
| SMILES | CC.CN1CCN2C(=O)OCCC2C1 |
| InChI | InChI=1S/C8H14N2O2.C2H6/c1-9-3-4-10-7(6-9)2-5-12-8(10)11;1-2/h7H,2-6H2,1H3;1-2H3 |
| InChIKey | UEBOPNQWZCCPMA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |