C17H14Cl2N2O2 — CID 145417058
5,7-bis(4-chlorophenyl)-2-oxa-5,7-diazaspiro[3.4]octan-6-one (PubChem CID 145417058) has the molecular formula C17H14Cl2N2O2 and a molecular weight of 349.22 g/mol. Its IUPAC name is 5,7-bis(4-chlorophenyl)-2-oxa-5,7-diazaspiro[3.4]octan-6-one.
| Compound Name | 5,7-bis(4-chlorophenyl)-2-oxa-5,7-diazaspiro[3.4]octan-6-one |
|---|---|
| PubChem CID | 145417058 |
| Molecular Formula | C17H14Cl2N2O2 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 5,7-bis(4-chlorophenyl)-2-oxa-5,7-diazaspiro[3.4]octan-6-one |
| SMILES | O=C1N(c2ccc(Cl)cc2)CC2(COC2)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14Cl2N2O2/c18-12-1-5-14(6-2-12)20-9-17(10-23-11-17)21(16(20)22)15-7-3-13(19)4-8-15/h1-8H,9-11H2 |
| InChIKey | JGAMTWUFWCDEMS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |