C28H29N7O3 — CID 145418013
3-cyclopentyl-3-[3-(1,3-dioxoisoindol-2-yl)-4-[7-(hydroxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propanenitrile;ethane (PubChem CID 145418013) has the molecular formula C28H29N7O3 and a molecular weight of 511.59 g/mol. Its IUPAC name is 3-cyclopentyl-3-[3-(1,3-dioxoisoindol-2-yl)-4-[7-(hydroxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propanenitrile;ethane.
| Compound Name | 3-cyclopentyl-3-[3-(1,3-dioxoisoindol-2-yl)-4-[7-(hydroxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propanenitrile;ethane |
|---|---|
| PubChem CID | 145418013 |
| Molecular Formula | C28H29N7O3 |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 3-cyclopentyl-3-[3-(1,3-dioxoisoindol-2-yl)-4-[7-(hydroxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propanenitrile;ethane |
| SMILES | CC.N#CCC(C1CCCC1)n1cc(-c2ncnc3c2ccn3CO)c(N2C(=O)c3ccccc3C2=O)n1 |
| InChI | InChI=1S/C26H23N7O3.C2H6/c27-11-9-21(16-5-1-2-6-16)32-13-20(22-19-10-12-31(15-34)23(19)29-14-28-22)24(30-32)33-25(35)17-7-3-4-8-18(17)26(33)36;1-2/h3-4,7-8,10,12-14,16,21,34H,1-2,5-6,9,15H2;1-2H3 |
| InChIKey | SOTRXGRYMKYMKY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|