C18H18B2N4 — CID 145418378
CID 145418378 (PubChem CID 145418378) has the molecular formula C18H18B2N4 and a molecular weight of 311.99 g/mol.
| Compound Name | CID 145418378 |
|---|---|
| PubChem CID | 145418378 |
| Molecular Formula | C18H18B2N4 |
| Molecular Weight | 311.99 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | — |
| SMILES | [B]N(Cc1nc2ccc(C)cc2n1[B])C1CCCc2cccnc21 |
| InChI | InChI=1S/C18H18B2N4/c1-12-7-8-14-16(10-12)24(20)17(22-14)11-23(19)15-6-2-4-13-5-3-9-21-18(13)15/h3,5,7-10,15H,2,4,6,11H2,1H3 |
| InChIKey | VNPOHTHNNXTXOL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.99 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|