C29H32ClN8O3S+ — CID 145418523
N-[3-[[5-amino-3-(7-azadispiro[2.0.54.33]dodecan-7-yl)-1,4-dihydro-1,2,4-triazin-1-ium-6-yl]sulfanyl]-2-chlorophenyl]-2-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide (PubChem CID 145418523) has the molecular formula C29H32ClN8O3S+ and a molecular weight of 608.15 g/mol. Its IUPAC name is N-[3-[[5-amino-3-(7-azadispiro[2.0.54.33]dodecan-7-yl)-1,4-dihydro-1,2,4-triazin-1-ium-6-yl]sulfanyl]-2-chlorophenyl]-2-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | N-[3-[[5-amino-3-(7-azadispiro[2.0.54.33]dodecan-7-yl)-1,4-dihydro-1,2,4-triazin-1-ium-6-yl]sulfanyl]-2-chlorophenyl]-2-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 145418523 |
| Molecular Formula | C29H32ClN8O3S+ |
| Molecular Weight | 608.15 g/mol |
| Exact Mass | 607.20 |
| IUPAC Name | N-[3-[[5-amino-3-(7-azadispiro[2.0.54.33]dodecan-7-yl)-1,4-dihydro-1,2,4-triazin-1-ium-6-yl]sulfanyl]-2-chlorophenyl]-2-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide |
| SMILES | NC1=C(Sc2cccc(NC(=O)c3c(O)nc4ccccn4c3=O)c2Cl)[NH2+]N=C(N2CCC3(CCCC34CC4)CC2)N1 |
| InChI | InChI=1S/C29H31ClN8O3S/c30-21-17(32-23(39)20-24(40)33-19-7-1-2-14-38(19)26(20)41)5-3-6-18(21)42-25-22(31)34-27(36-35-25)37-15-12-29(13-16-37)9-4-8-28(29)10-11-28/h1-3,5-7,14,35,40H,4,8-13,15-16,31H2,(H,32,39)(H,34,36)/p+1 |
| InChIKey | POWJTYJCMVIGAU-UHFFFAOYSA-O |
| XLogP | 2.97 |
| TPSA | 153.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.15 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|