About ditert-butyl pyrrolidin-3-yl phosphate
ditert-butyl pyrrolidin-3-yl phosphate (PubChem CID 145418553) has the molecular formula C12H26NO4P
and a molecular weight of 279.32 g/mol. Its IUPAC name is ditert-butyl pyrrolidin-3-yl phosphate.
Molecular Properties
| Compound Name | ditert-butyl pyrrolidin-3-yl phosphate |
| PubChem CID | 145418553 |
| Molecular Formula | C12H26NO4P |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | ditert-butyl pyrrolidin-3-yl phosphate |
| SMILES | CC(C)(C)OP(=O)(OC1CCNC1)OC(C)(C)C |
| InChI | InChI=1S/C12H26NO4P/c1-11(2,3)16-18(14,17-12(4,5)6)15-10-7-8-13-9-10/h10,13H,7-9H2,1-6H3 |
| InChIKey | BSDDJUDCLJXURU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl pyrrolidin-3-yl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl pyrrolidin-3-yl phosphate?
The IUPAC name of ditert-butyl pyrrolidin-3-yl phosphate (CID 145418553) is ditert-butyl pyrrolidin-3-yl phosphate.
What is the SMILES notation for ditert-butyl pyrrolidin-3-yl phosphate?
The canonical SMILES for ditert-butyl pyrrolidin-3-yl phosphate is CC(C)(C)OP(=O)(OC1CCNC1)OC(C)(C)C.
What is the InChIKey of ditert-butyl pyrrolidin-3-yl phosphate?
The InChIKey is BSDDJUDCLJXURU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26NO4P/c1-11(2,3)16-18(14,17-12(4,5)6)15-10-7-8-13-9-10/h10,13H,7-9H2,1-6H3.
What are the key properties of ditert-butyl pyrrolidin-3-yl phosphate?
ditert-butyl pyrrolidin-3-yl phosphate has a molecular weight of 279.32 g/mol, XLogP of 3.10, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl pyrrolidin-3-yl phosphate is sourced from PubChem (CID 145418553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).