C26H29NO9 — CID 145418831
(2S,3S)-4-amino-2-methyloxan-3-ol;6,7,11-trihydroxy-9-(2-hydroxyacetyl)-7,8,9,10-tetrahydrotetracene-5,12-dione (PubChem CID 145418831) has the molecular formula C26H29NO9 and a molecular weight of 499.52 g/mol. Its IUPAC name is (2S,3S)-4-amino-2-methyloxan-3-ol;6,7,11-trihydroxy-9-(2-hydroxyacetyl)-7,8,9,10-tetrahydrotetracene-5,12-dione.
| Compound Name | (2S,3S)-4-amino-2-methyloxan-3-ol;6,7,11-trihydroxy-9-(2-hydroxyacetyl)-7,8,9,10-tetrahydrotetracene-5,12-dione |
|---|---|
| PubChem CID | 145418831 |
| Molecular Formula | C26H29NO9 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | (2S,3S)-4-amino-2-methyloxan-3-ol;6,7,11-trihydroxy-9-(2-hydroxyacetyl)-7,8,9,10-tetrahydrotetracene-5,12-dione |
| SMILES | C[C@@H]1OCCC(N)[C@@H]1O.O=C1c2ccccc2C(=O)c2c(O)c3c(c(O)c21)CC(C(=O)CO)CC3O |
| InChI | InChI=1S/C20H16O7.C6H13NO2/c21-7-13(23)8-5-11-14(12(22)6-8)20(27)16-15(19(11)26)17(24)9-3-1-2-4-10(9)18(16)25;1-4-6(8)5(7)2-3-9-4/h1-4,8,12,21-22,26-27H,5-7H2;4-6,8H,2-3,7H2,1H3/t;4-,5?,6+/m.0/s1 |
| InChIKey | GBNXAJKOKUUELM-RVACTLGCSA-N |
| XLogP | 0.51 |
| TPSA | 187.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|