About N-prop-1-en-2-yl-1H-1,2,4-triazol-5-amine
N-prop-1-en-2-yl-1H-1,2,4-triazol-5-amine (PubChem CID 145418887) has the molecular formula C5H8N4
and a molecular weight of 124.15 g/mol. Its IUPAC name is N-prop-1-en-2-yl-1H-1,2,4-triazol-5-amine.
Molecular Properties
| Compound Name | N-prop-1-en-2-yl-1H-1,2,4-triazol-5-amine |
| PubChem CID | 145418887 |
| Molecular Formula | C5H8N4 |
| Molecular Weight | 124.15 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | N-prop-1-en-2-yl-1H-1,2,4-triazol-5-amine |
| SMILES | C=C(C)Nc1ncn[nH]1 |
| InChI | InChI=1S/C5H8N4/c1-4(2)8-5-6-3-7-9-5/h3H,1H2,2H3,(H2,6,7,8,9) |
| InChIKey | OJHQCHLCVNGGTB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.15 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-prop-1-en-2-yl-1H-1,2,4-triazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-1-en-2-yl-1H-1,2,4-triazol-5-amine?
The IUPAC name of N-prop-1-en-2-yl-1H-1,2,4-triazol-5-amine (CID 145418887) is N-prop-1-en-2-yl-1H-1,2,4-triazol-5-amine.
What is the SMILES notation for N-prop-1-en-2-yl-1H-1,2,4-triazol-5-amine?
The canonical SMILES for N-prop-1-en-2-yl-1H-1,2,4-triazol-5-amine is C=C(C)Nc1ncn[nH]1.
What is the InChIKey of N-prop-1-en-2-yl-1H-1,2,4-triazol-5-amine?
The InChIKey is OJHQCHLCVNGGTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4/c1-4(2)8-5-6-3-7-9-5/h3H,1H2,2H3,(H2,6,7,8,9).
What are the key properties of N-prop-1-en-2-yl-1H-1,2,4-triazol-5-amine?
N-prop-1-en-2-yl-1H-1,2,4-triazol-5-amine has a molecular weight of 124.15 g/mol, XLogP of 0.75, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-1-en-2-yl-1H-1,2,4-triazol-5-amine is sourced from PubChem (CID 145418887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).