C20H22F2O — CID 145418904
(3Z,7Z,11Z)-7,8-difluoro-2-methoxy-13-methyl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene (PubChem CID 145418904) has the molecular formula C20H22F2O and a molecular weight of 316.39 g/mol. Its IUPAC name is (3Z,7Z,11Z)-7,8-difluoro-2-methoxy-13-methyl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene.
| Compound Name | (3Z,7Z,11Z)-7,8-difluoro-2-methoxy-13-methyl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene |
|---|---|
| PubChem CID | 145418904 |
| Molecular Formula | C20H22F2O |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (3Z,7Z,11Z)-7,8-difluoro-2-methoxy-13-methyl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene |
| SMILES | C=C(C)/C=C\C(=C)C(=C)/C(F)=C(/F)C(=C)C(=C)/C=C\C(=C)OC |
| InChI | InChI=1S/C20H22F2O/c1-13(2)9-10-14(3)17(6)19(21)20(22)18(7)15(4)11-12-16(5)23-8/h9-12H,1,3-7H2,2,8H3/b10-9-,12-11-,20-19- |
| InChIKey | VCOFKWGPNJOPRG-MWIWIWLWSA-N |
| XLogP | 6.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|