C15H32N2O2 — CID 145418996
3-(2,2,3,5,5-pentamethylhexan-3-yloxy)propylurea (PubChem CID 145418996) has the molecular formula C15H32N2O2 and a molecular weight of 272.43 g/mol. Its IUPAC name is 3-(2,2,3,5,5-pentamethylhexan-3-yloxy)propylurea.
| Compound Name | 3-(2,2,3,5,5-pentamethylhexan-3-yloxy)propylurea |
|---|---|
| PubChem CID | 145418996 |
| Molecular Formula | C15H32N2O2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | 3-(2,2,3,5,5-pentamethylhexan-3-yloxy)propylurea |
| SMILES | CC(C)(C)CC(C)(OCCCNC(N)=O)C(C)(C)C |
| InChI | InChI=1S/C15H32N2O2/c1-13(2,3)11-15(7,14(4,5)6)19-10-8-9-17-12(16)18/h8-11H2,1-7H3,(H3,16,17,18) |
| InChIKey | ZCEAANUBCFAJLL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|