C16H33NO2 — CID 145419014
3-[2-(2,2,3,5,5-pentamethylhexan-3-yl)oxiran-2-yl]oxypropan-1-amine (PubChem CID 145419014) has the molecular formula C16H33NO2 and a molecular weight of 271.44 g/mol. Its IUPAC name is 3-[2-(2,2,3,5,5-pentamethylhexan-3-yl)oxiran-2-yl]oxypropan-1-amine.
| Compound Name | 3-[2-(2,2,3,5,5-pentamethylhexan-3-yl)oxiran-2-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 145419014 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | 3-[2-(2,2,3,5,5-pentamethylhexan-3-yl)oxiran-2-yl]oxypropan-1-amine |
| SMILES | CC(C)(C)CC(C)(C(C)(C)C)C1(OCCCN)CO1 |
| InChI | InChI=1S/C16H33NO2/c1-13(2,3)11-15(7,14(4,5)6)16(12-19-16)18-10-8-9-17/h8-12,17H2,1-7H3 |
| InChIKey | DFUBLEIKAMPSKL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 47.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|