C15H14B3F3N6O2 — CID 145419848
CID 145419848 (PubChem CID 145419848) has the molecular formula C15H14B3F3N6O2 and a molecular weight of 399.75 g/mol.
| Compound Name | CID 145419848 |
|---|---|
| PubChem CID | 145419848 |
| Molecular Formula | C15H14B3F3N6O2 |
| Molecular Weight | 399.75 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])n1nc(C2(C)CCOC2=O)cc1Nc1ncc(C(F)(F)F)c(NC)n1 |
| InChI | InChI=1S/C15H14B3F3N6O2/c1-13(3-4-29-11(13)28)8-5-9(27(26-8)15(16,17)18)24-12-23-6-7(14(19,20)21)10(22-2)25-12/h5-6H,3-4H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | YFXMQSNKVGLOQF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.75 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|