C23H30N6 — CID 145420434
1-N'-[4-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]-1-N-ethylethene-1,1-diamine (PubChem CID 145420434) has the molecular formula C23H30N6 and a molecular weight of 390.54 g/mol. Its IUPAC name is 1-N'-[4-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]-1-N-ethylethene-1,1-diamine.
| Compound Name | 1-N'-[4-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]-1-N-ethylethene-1,1-diamine |
|---|---|
| PubChem CID | 145420434 |
| Molecular Formula | C23H30N6 |
| Molecular Weight | 390.54 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | 1-N'-[4-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]-1-N-ethylethene-1,1-diamine |
| SMILES | C=C(NCC)Nc1ccc(-c2nc(N3C[C@H](C)C[C@H](C)C3)c3cccn3n2)cc1 |
| InChI | InChI=1S/C23H30N6/c1-5-24-18(4)25-20-10-8-19(9-11-20)22-26-23(21-7-6-12-29(21)27-22)28-14-16(2)13-17(3)15-28/h6-12,16-17,24-25H,4-5,13-15H2,1-3H3/t16-,17+ |
| InChIKey | VMTPVQDRFJPWQR-CALCHBBNSA-N |
| XLogP | 4.37 |
| TPSA | 57.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |