C21H8Br2F5NO — CID 145420586
3,10-dibromo-6-(2,3,4,5,6-pentafluorophenyl)-6H-indolo[1,2-c][1,3]benzoxazine (PubChem CID 145420586) has the molecular formula C21H8Br2F5NO and a molecular weight of 545.10 g/mol. Its IUPAC name is 3,10-dibromo-6-(2,3,4,5,6-pentafluorophenyl)-6H-indolo[1,2-c][1,3]benzoxazine.
| Compound Name | 3,10-dibromo-6-(2,3,4,5,6-pentafluorophenyl)-6H-indolo[1,2-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 145420586 |
| Molecular Formula | C21H8Br2F5NO |
| Molecular Weight | 545.10 g/mol |
| Exact Mass | 542.89 |
| IUPAC Name | 3,10-dibromo-6-(2,3,4,5,6-pentafluorophenyl)-6H-indolo[1,2-c][1,3]benzoxazine |
| SMILES | Fc1c(F)c(F)c(C2Oc3cc(Br)ccc3-c3cc4cc(Br)ccc4n32)c(F)c1F |
| InChI | InChI=1S/C21H8Br2F5NO/c22-9-2-4-12-8(5-9)6-13-11-3-1-10(23)7-14(11)30-21(29(12)13)15-16(24)18(26)20(28)19(27)17(15)25/h1-7,21H |
| InChIKey | PPRWWJIFEDUANL-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.10 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|