C17H20F4O2 — CID 145420674
(3Z,7Z)-2-ethoxy-3,4,7,8-tetrafluoro-11-methoxy-5,6,9-trimethylideneundeca-1,3,7-triene (PubChem CID 145420674) has the molecular formula C17H20F4O2 and a molecular weight of 332.34 g/mol. Its IUPAC name is (3Z,7Z)-2-ethoxy-3,4,7,8-tetrafluoro-11-methoxy-5,6,9-trimethylideneundeca-1,3,7-triene.
| Compound Name | (3Z,7Z)-2-ethoxy-3,4,7,8-tetrafluoro-11-methoxy-5,6,9-trimethylideneundeca-1,3,7-triene |
|---|---|
| PubChem CID | 145420674 |
| Molecular Formula | C17H20F4O2 |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (3Z,7Z)-2-ethoxy-3,4,7,8-tetrafluoro-11-methoxy-5,6,9-trimethylideneundeca-1,3,7-triene |
| SMILES | C=C(OCC)/C(F)=C(/F)C(=C)C(=C)/C(F)=C(\F)C(=C)CCOC |
| InChI | InChI=1S/C17H20F4O2/c1-7-23-13(5)17(21)16(20)12(4)11(3)15(19)14(18)10(2)8-9-22-6/h2-5,7-9H2,1,6H3/b15-14-,17-16- |
| InChIKey | BPHPOEYEZSNIRG-WHEHHYQMSA-N |
| XLogP | 5.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|