C19H24F4O2 — CID 145420686
(3Z,7Z)-2-butoxy-3,4,7,8-tetrafluoro-11-methoxy-5,6,9-trimethylideneundeca-1,3,7-triene (PubChem CID 145420686) has the molecular formula C19H24F4O2 and a molecular weight of 360.39 g/mol. Its IUPAC name is (3Z,7Z)-2-butoxy-3,4,7,8-tetrafluoro-11-methoxy-5,6,9-trimethylideneundeca-1,3,7-triene.
| Compound Name | (3Z,7Z)-2-butoxy-3,4,7,8-tetrafluoro-11-methoxy-5,6,9-trimethylideneundeca-1,3,7-triene |
|---|---|
| PubChem CID | 145420686 |
| Molecular Formula | C19H24F4O2 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (3Z,7Z)-2-butoxy-3,4,7,8-tetrafluoro-11-methoxy-5,6,9-trimethylideneundeca-1,3,7-triene |
| SMILES | C=C(CCOC)/C(F)=C(/F)C(=C)C(=C)/C(F)=C(\F)C(=C)OCCCC |
| InChI | InChI=1S/C19H24F4O2/c1-7-8-10-25-15(5)19(23)18(22)14(4)13(3)17(21)16(20)12(2)9-11-24-6/h2-5,7-11H2,1,6H3/b17-16-,19-18- |
| InChIKey | HFOWPRLHWFSVJO-BLLVGQQCSA-N |
| XLogP | 6.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|