C15H20N6O2S — CID 145420809
4-amino-2-butoxy-8-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,7-dihydropteridin-6-one (PubChem CID 145420809) has the molecular formula C15H20N6O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is 4-amino-2-butoxy-8-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,7-dihydropteridin-6-one.
| Compound Name | 4-amino-2-butoxy-8-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 145420809 |
| Molecular Formula | C15H20N6O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 4-amino-2-butoxy-8-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,7-dihydropteridin-6-one |
| SMILES | CCCCOc1nc(N)c2c(n1)N(Cc1csc(C)n1)CC(=O)N2 |
| InChI | InChI=1S/C15H20N6O2S/c1-3-4-5-23-15-19-13(16)12-14(20-15)21(7-11(22)18-12)6-10-8-24-9(2)17-10/h8H,3-7H2,1-2H3,(H,18,22)(H2,16,19,20) |
| InChIKey | CZMCIFBIEMIECV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|