5-amino-2,7-dimethyl-4-oxooctanoic acid

C10H19NO3 — CID 14542144

IUPAC5-amino-2,7-dimethyl-4-oxooctanoic acid
SMILESCC(C)CC(N)C(=O)CC(C)C(=O)O
InChIInChI=1S/C10H19NO3/c1-6(2)4-8(11)9(12)5-7(3)10(13)14/h6-8H,4-5,11H2,1-3H3,(H,13,14)
InChIKeyXJWWFJPYTISCLD-UHFFFAOYSA-N
MW201.27 g/mol
LogP1.04
Rot. Bonds6

About 5-amino-2,7-dimethyl-4-oxooctanoic acid

5-amino-2,7-dimethyl-4-oxooctanoic acid (PubChem CID 14542144) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 5-amino-2,7-dimethyl-4-oxooctanoic acid.

Molecular Properties

Compound Name5-amino-2,7-dimethyl-4-oxooctanoic acid
PubChem CID14542144
Molecular FormulaC10H19NO3
Molecular Weight201.27 g/mol
Exact Mass201.14
IUPAC Name5-amino-2,7-dimethyl-4-oxooctanoic acid
SMILESCC(C)CC(N)C(=O)CC(C)C(=O)O
InChIInChI=1S/C10H19NO3/c1-6(2)4-8(11)9(12)5-7(3)10(13)14/h6-8H,4-5,11H2,1-3H3,(H,13,14)
InChIKeyXJWWFJPYTISCLD-UHFFFAOYSA-N
XLogP1.04
TPSA80.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.27
LogP ≤ 51.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 5-amino-2,7-dimethyl-4-oxooctanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-amino-2,7-dimethyl-4-oxooctanoic acid?
The IUPAC name of 5-amino-2,7-dimethyl-4-oxooctanoic acid (CID 14542144) is 5-amino-2,7-dimethyl-4-oxooctanoic acid.
What is the SMILES notation for 5-amino-2,7-dimethyl-4-oxooctanoic acid?
The canonical SMILES for 5-amino-2,7-dimethyl-4-oxooctanoic acid is CC(C)CC(N)C(=O)CC(C)C(=O)O.
What is the InChIKey of 5-amino-2,7-dimethyl-4-oxooctanoic acid?
The InChIKey is XJWWFJPYTISCLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-6(2)4-8(11)9(12)5-7(3)10(13)14/h6-8H,4-5,11H2,1-3H3,(H,13,14).
What are the key properties of 5-amino-2,7-dimethyl-4-oxooctanoic acid?
5-amino-2,7-dimethyl-4-oxooctanoic acid has a molecular weight of 201.27 g/mol, XLogP of 1.04, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,7-dimethyl-4-oxooctanoic acid is sourced from PubChem (CID 14542144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).