About 5-amino-2,7-dimethyl-4-oxooctanoic acid
5-amino-2,7-dimethyl-4-oxooctanoic acid (PubChem CID 14542144) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 5-amino-2,7-dimethyl-4-oxooctanoic acid.
Molecular Properties
| Compound Name | 5-amino-2,7-dimethyl-4-oxooctanoic acid |
| PubChem CID | 14542144 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 5-amino-2,7-dimethyl-4-oxooctanoic acid |
| SMILES | CC(C)CC(N)C(=O)CC(C)C(=O)O |
| InChI | InChI=1S/C10H19NO3/c1-6(2)4-8(11)9(12)5-7(3)10(13)14/h6-8H,4-5,11H2,1-3H3,(H,13,14) |
| InChIKey | XJWWFJPYTISCLD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-2,7-dimethyl-4-oxooctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2,7-dimethyl-4-oxooctanoic acid?
The IUPAC name of 5-amino-2,7-dimethyl-4-oxooctanoic acid (CID 14542144) is 5-amino-2,7-dimethyl-4-oxooctanoic acid.
What is the SMILES notation for 5-amino-2,7-dimethyl-4-oxooctanoic acid?
The canonical SMILES for 5-amino-2,7-dimethyl-4-oxooctanoic acid is CC(C)CC(N)C(=O)CC(C)C(=O)O.
What is the InChIKey of 5-amino-2,7-dimethyl-4-oxooctanoic acid?
The InChIKey is XJWWFJPYTISCLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-6(2)4-8(11)9(12)5-7(3)10(13)14/h6-8H,4-5,11H2,1-3H3,(H,13,14).
What are the key properties of 5-amino-2,7-dimethyl-4-oxooctanoic acid?
5-amino-2,7-dimethyl-4-oxooctanoic acid has a molecular weight of 201.27 g/mol, XLogP of 1.04, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,7-dimethyl-4-oxooctanoic acid is sourced from PubChem (CID 14542144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).