C37H41BN2O2 — CID 145421867
ethane;4-phenyl-N-(1-phenylethylidene)-N'-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]benzenecarboximidamide (PubChem CID 145421867) has the molecular formula C37H41BN2O2 and a molecular weight of 556.56 g/mol. Its IUPAC name is ethane;4-phenyl-N-(1-phenylethylidene)-N'-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]benzenecarboximidamide.
| Compound Name | ethane;4-phenyl-N-(1-phenylethylidene)-N'-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145421867 |
| Molecular Formula | C37H41BN2O2 |
| Molecular Weight | 556.56 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | ethane;4-phenyl-N-(1-phenylethylidene)-N'-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]benzenecarboximidamide |
| SMILES | C=C(/N=C(\N=C(/C)c1ccccc1)c1ccc(-c2ccccc2)cc1)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1.CC |
| InChI | InChI=1S/C35H35BN2O2.C2H6/c1-25(27-13-9-7-10-14-27)37-33(31-19-17-30(18-20-31)29-15-11-8-12-16-29)38-26(2)28-21-23-32(24-22-28)36-39-34(3,4)35(5,6)40-36;1-2/h7-24H,2H2,1,3-6H3;1-2H3/b37-25+,38-33-; |
| InChIKey | VRPOEFUCSGGYIN-KMPJPUEPSA-N |
| XLogP | 8.61 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.56 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|