C41H39BN2O2 — CID 145422010
4-phenyl-N-[1-(4-phenylphenyl)ethylidene]-N'-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]benzenecarboximidamide (PubChem CID 145422010) has the molecular formula C41H39BN2O2 and a molecular weight of 602.59 g/mol. Its IUPAC name is 4-phenyl-N-[1-(4-phenylphenyl)ethylidene]-N'-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]benzenecarboximidamide.
| Compound Name | 4-phenyl-N-[1-(4-phenylphenyl)ethylidene]-N'-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145422010 |
| Molecular Formula | C41H39BN2O2 |
| Molecular Weight | 602.59 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | 4-phenyl-N-[1-(4-phenylphenyl)ethylidene]-N'-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]benzenecarboximidamide |
| SMILES | C=C(/N=C(\N=C(/C)c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cc1)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C41H39BN2O2/c1-29(31-17-19-35(20-18-31)33-13-9-7-10-14-33)43-39(37-23-21-36(22-24-37)34-15-11-8-12-16-34)44-30(2)32-25-27-38(28-26-32)42-45-40(3,4)41(5,6)46-42/h7-28H,2H2,1,3-6H3/b43-29+,44-39- |
| InChIKey | JZCTWUFLSPJPIZ-GFVGXAGISA-N |
| XLogP | 9.25 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.59 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|