About 6-(2-methoxyethyl)undecane;(2-nonyl-11-oxoundecyl) 1-methylpiperidine-4-carboxylate
6-(2-methoxyethyl)undecane;(2-nonyl-11-oxoundecyl) 1-methylpiperidine-4-carboxylate (PubChem CID 145422057) has the molecular formula C41H81NO4
and a molecular weight of 652.10 g/mol. Its IUPAC name is 6-(2-methoxyethyl)undecane;(2-nonyl-11-oxoundecyl) 1-methylpiperidine-4-carboxylate.
Molecular Properties
| Compound Name | 6-(2-methoxyethyl)undecane;(2-nonyl-11-oxoundecyl) 1-methylpiperidine-4-carboxylate |
| PubChem CID | 145422057 |
| Molecular Formula | C41H81NO4 |
| Molecular Weight | 652.10 g/mol |
| Exact Mass | 651.62 |
| IUPAC Name | 6-(2-methoxyethyl)undecane;(2-nonyl-11-oxoundecyl) 1-methylpiperidine-4-carboxylate |
| SMILES | CCCCCC(CCCCC)CCOC.CCCCCCCCCC(CCCCCCCCC=O)COC(=O)C1CCN(C)CC1 |
| InChI | InChI=1S/C27H51NO3.C14H30O/c1-3-4-5-6-8-11-14-17-25(18-15-12-9-7-10-13-16-23-29)24-31-27(30)26-19-21-28(2)22-20-26;1-4-6-8-10-14(12-13-15-3)11-9-7-5-2/h23,25-26H,3-22,24H2,1-2H3;14H,4-13H2,1-3H3 |
| InChIKey | ZVWHFZOGJKZNSU-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 652.10 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-methoxyethyl)undecane;(2-nonyl-11-oxoundecyl) 1-methylpiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methoxyethyl)undecane;(2-nonyl-11-oxoundecyl) 1-methylpiperidine-4-carboxylate?
The IUPAC name of 6-(2-methoxyethyl)undecane;(2-nonyl-11-oxoundecyl) 1-methylpiperidine-4-carboxylate (CID 145422057) is 6-(2-methoxyethyl)undecane;(2-nonyl-11-oxoundecyl) 1-methylpiperidine-4-carboxylate.
What is the SMILES notation for 6-(2-methoxyethyl)undecane;(2-nonyl-11-oxoundecyl) 1-methylpiperidine-4-carboxylate?
The canonical SMILES for 6-(2-methoxyethyl)undecane;(2-nonyl-11-oxoundecyl) 1-methylpiperidine-4-carboxylate is CCCCCC(CCCCC)CCOC.CCCCCCCCCC(CCCCCCCCC=O)COC(=O)C1CCN(C)CC1.
What is the InChIKey of 6-(2-methoxyethyl)undecane;(2-nonyl-11-oxoundecyl) 1-methylpiperidine-4-carboxylate?
The InChIKey is ZVWHFZOGJKZNSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H51NO3.C14H30O/c1-3-4-5-6-8-11-14-17-25(18-15-12-9-7-10-13-16-23-29)24-31-27(30)26-19-21-28(2)22-20-26;1-4-6-8-10-14(12-13-15-3)11-9-7-5-2/h23,25-26H,3-22,24H2,1-2H3;14H,4-13H2,1-3H3.
What are the key properties of 6-(2-methoxyethyl)undecane;(2-nonyl-11-oxoundecyl) 1-methylpiperidine-4-carboxylate?
6-(2-methoxyethyl)undecane;(2-nonyl-11-oxoundecyl) 1-methylpiperidine-4-carboxylate has a molecular weight of 652.10 g/mol, XLogP of 11.75, 31 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methoxyethyl)undecane;(2-nonyl-11-oxoundecyl) 1-methylpiperidine-4-carboxylate is sourced from PubChem (CID 145422057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).