C41H81NO4 — CID 145422057
6-(2-methoxyethyl)undecane;(2-nonyl-11-oxoundecyl) 1-methylpiperidine-4-carboxylate (PubChem CID 145422057) has the molecular formula C41H81NO4 and a molecular weight of 652.10 g/mol. Its IUPAC name is 6-(2-methoxyethyl)undecane;(2-nonyl-11-oxoundecyl) 1-methylpiperidine-4-carboxylate.
| Compound Name | 6-(2-methoxyethyl)undecane;(2-nonyl-11-oxoundecyl) 1-methylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 145422057 |
| Molecular Formula | C41H81NO4 |
| Molecular Weight | 652.10 g/mol |
| Exact Mass | 651.62 |
| IUPAC Name | 6-(2-methoxyethyl)undecane;(2-nonyl-11-oxoundecyl) 1-methylpiperidine-4-carboxylate |
| SMILES | CCCCCC(CCCCC)CCOC.CCCCCCCCCC(CCCCCCCCC=O)COC(=O)C1CCN(C)CC1 |
| InChI | InChI=1S/C27H51NO3.C14H30O/c1-3-4-5-6-8-11-14-17-25(18-15-12-9-7-10-13-16-23-29)24-31-27(30)26-19-21-28(2)22-20-26;1-4-6-8-10-14(12-13-15-3)11-9-7-5-2/h23,25-26H,3-22,24H2,1-2H3;14H,4-13H2,1-3H3 |
| InChIKey | ZVWHFZOGJKZNSU-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.10 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|