About cyclohexanecarbaldehyde;methanamine;N-methyl-3-(trifluoromethyl)-10H-phenothiazin-1-amine
cyclohexanecarbaldehyde;methanamine;N-methyl-3-(trifluoromethyl)-10H-phenothiazin-1-amine (PubChem CID 145422320) has the molecular formula C22H28F3N3OS
and a molecular weight of 439.55 g/mol. Its IUPAC name is cyclohexanecarbaldehyde;methanamine;N-methyl-3-(trifluoromethyl)-10H-phenothiazin-1-amine.
Molecular Properties
| Compound Name | cyclohexanecarbaldehyde;methanamine;N-methyl-3-(trifluoromethyl)-10H-phenothiazin-1-amine |
| PubChem CID | 145422320 |
| Molecular Formula | C22H28F3N3OS |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | cyclohexanecarbaldehyde;methanamine;N-methyl-3-(trifluoromethyl)-10H-phenothiazin-1-amine |
| SMILES | CN.CNc1cc(C(F)(F)F)cc2c1Nc1ccccc1S2.O=CC1CCCCC1 |
| InChI | InChI=1S/C14H11F3N2S.C7H12O.CH5N/c1-18-10-6-8(14(15,16)17)7-12-13(10)19-9-4-2-3-5-11(9)20-12;8-6-7-4-2-1-3-5-7;1-2/h2-7,18-19H,1H3;6-7H,1-5H2;2H2,1H3 |
| InChIKey | XXBWCBLRNWCZSE-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze cyclohexanecarbaldehyde;methanamine;N-methyl-3-(trifluoromethyl)-10H-phenothiazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanecarbaldehyde;methanamine;N-methyl-3-(trifluoromethyl)-10H-phenothiazin-1-amine?
The IUPAC name of cyclohexanecarbaldehyde;methanamine;N-methyl-3-(trifluoromethyl)-10H-phenothiazin-1-amine (CID 145422320) is cyclohexanecarbaldehyde;methanamine;N-methyl-3-(trifluoromethyl)-10H-phenothiazin-1-amine.
What is the SMILES notation for cyclohexanecarbaldehyde;methanamine;N-methyl-3-(trifluoromethyl)-10H-phenothiazin-1-amine?
The canonical SMILES for cyclohexanecarbaldehyde;methanamine;N-methyl-3-(trifluoromethyl)-10H-phenothiazin-1-amine is CN.CNc1cc(C(F)(F)F)cc2c1Nc1ccccc1S2.O=CC1CCCCC1.
What is the InChIKey of cyclohexanecarbaldehyde;methanamine;N-methyl-3-(trifluoromethyl)-10H-phenothiazin-1-amine?
The InChIKey is XXBWCBLRNWCZSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F3N2S.C7H12O.CH5N/c1-18-10-6-8(14(15,16)17)7-12-13(10)19-9-4-2-3-5-11(9)20-12;8-6-7-4-2-1-3-5-7;1-2/h2-7,18-19H,1H3;6-7H,1-5H2;2H2,1H3.
What are the key properties of cyclohexanecarbaldehyde;methanamine;N-methyl-3-(trifluoromethyl)-10H-phenothiazin-1-amine?
cyclohexanecarbaldehyde;methanamine;N-methyl-3-(trifluoromethyl)-10H-phenothiazin-1-amine has a molecular weight of 439.55 g/mol, XLogP of 6.30, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanecarbaldehyde;methanamine;N-methyl-3-(trifluoromethyl)-10H-phenothiazin-1-amine is sourced from PubChem (CID 145422320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).