C22H23N5O2S — CID 145422806
N-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]benzamide (PubChem CID 145422806) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is N-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]benzamide.
| Compound Name | N-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 145422806 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]benzamide |
| SMILES | Cc1cc(CSc2ccccc2C(=O)NCCNCc2nc3ccccc3[nH]2)no1 |
| InChI | InChI=1S/C22H23N5O2S/c1-15-12-16(27-29-15)14-30-20-9-5-2-6-17(20)22(28)24-11-10-23-13-21-25-18-7-3-4-8-19(18)26-21/h2-9,12,23H,10-11,13-14H2,1H3,(H,24,28)(H,25,26) |
| InChIKey | OLNNOSBYXNFIPJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|